C8H8N6O — CID 47138375
N-(2-cyanoethyl)-2-(3-cyano-1,2,4-triazol-4-yl)acetamide (PubChem CID 47138375) has the molecular formula C8H8N6O and a molecular weight of 204.19 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(3-cyano-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(3-cyano-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 47138375 |
| Molecular Formula | C8H8N6O |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | N-(2-cyanoethyl)-2-(3-cyano-1,2,4-triazol-4-yl)acetamide |
| SMILES | N#CCCNC(=O)Cn1cnnc1C#N |
| InChI | InChI=1S/C8H8N6O/c9-2-1-3-11-8(15)5-14-6-12-13-7(14)4-10/h6H,1,3,5H2,(H,11,15) |
| InChIKey | DOQDCBAGCXAWTR-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|