C8H11N5O — CID 165473943
2-(4-aminoimidazol-1-yl)-N-(2-cyanoethyl)acetamide (PubChem CID 165473943) has the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-(4-aminoimidazol-1-yl)-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-(4-aminoimidazol-1-yl)-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 165473943 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 2-(4-aminoimidazol-1-yl)-N-(2-cyanoethyl)acetamide |
| SMILES | N#CCCNC(=O)Cn1cnc(N)c1 |
| InChI | InChI=1S/C8H11N5O/c9-2-1-3-11-8(14)5-13-4-7(10)12-6-13/h4,6H,1,3,5,10H2,(H,11,14) |
| InChIKey | RZKHDAHMOYOBHL-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|