C11H17N5O — CID 47125315
2-(3-cyano-1,2,4-triazol-4-yl)-N-hexylacetamide (PubChem CID 47125315) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-(3-cyano-1,2,4-triazol-4-yl)-N-hexylacetamide.
| Compound Name | 2-(3-cyano-1,2,4-triazol-4-yl)-N-hexylacetamide |
|---|---|
| PubChem CID | 47125315 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-(3-cyano-1,2,4-triazol-4-yl)-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)Cn1cnnc1C#N |
| InChI | InChI=1S/C11H17N5O/c1-2-3-4-5-6-13-11(17)8-16-9-14-15-10(16)7-12/h9H,2-6,8H2,1H3,(H,13,17) |
| InChIKey | ITYDETYHVLBODP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|