C13H20F3N3O — CID 19519068
N-hexyl-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 19519068) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is N-hexyl-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-hexyl-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19519068 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-hexyl-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CCCCCCNC(=O)Cn1nc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C13H20F3N3O/c1-3-4-5-6-7-17-12(20)9-19-10(2)8-11(18-19)13(14,15)16/h8H,3-7,9H2,1-2H3,(H,17,20) |
| InChIKey | ORUCYSWGKYFOAH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|