C13H16F3N5O — CID 19519237
N-[(1-ethylpyrazol-3-yl)methyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 19519237) has the molecular formula C13H16F3N5O and a molecular weight of 315.30 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-3-yl)methyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[(1-ethylpyrazol-3-yl)methyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19519237 |
| Molecular Formula | C13H16F3N5O |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-[(1-ethylpyrazol-3-yl)methyl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CCn1ccc(CNC(=O)Cn2nc(C(F)(F)F)cc2C)n1 |
| InChI | InChI=1S/C13H16F3N5O/c1-3-20-5-4-10(18-20)7-17-12(22)8-21-9(2)6-11(19-21)13(14,15)16/h4-6H,3,7-8H2,1-2H3,(H,17,22) |
| InChIKey | FHQJLNTVNPGDBL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |