C15H19F2N5O — CID 19530318
2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[(1-ethylpyrazol-3-yl)methyl]acetamide (PubChem CID 19530318) has the molecular formula C15H19F2N5O and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[(1-ethylpyrazol-3-yl)methyl]acetamide.
| Compound Name | 2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[(1-ethylpyrazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 19530318 |
| Molecular Formula | C15H19F2N5O |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-[3-cyclopropyl-5-(difluoromethyl)pyrazol-1-yl]-N-[(1-ethylpyrazol-3-yl)methyl]acetamide |
| SMILES | CCn1ccc(CNC(=O)Cn2nc(C3CC3)cc2C(F)F)n1 |
| InChI | InChI=1S/C15H19F2N5O/c1-2-21-6-5-11(19-21)8-18-14(23)9-22-13(15(16)17)7-12(20-22)10-3-4-10/h5-7,10,15H,2-4,8-9H2,1H3,(H,18,23) |
| InChIKey | NDNGUWOFDSCRMN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |