C13H21F2N3O — CID 19523586
2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-hexylacetamide (PubChem CID 19523586) has the molecular formula C13H21F2N3O and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-hexylacetamide.
| Compound Name | 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-hexylacetamide |
|---|---|
| PubChem CID | 19523586 |
| Molecular Formula | C13H21F2N3O |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)Cn1nc(C(F)F)cc1C |
| InChI | InChI=1S/C13H21F2N3O/c1-3-4-5-6-7-16-12(19)9-18-10(2)8-11(17-18)13(14)15/h8,13H,3-7,9H2,1-2H3,(H,16,19) |
| InChIKey | AFQGHTMLSPYRGO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|