C6H6N4O2 — CID 131154678
methyl 2-(3-cyano-1,2,4-triazol-4-yl)acetate (PubChem CID 131154678) has the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. Its IUPAC name is methyl 2-(3-cyano-1,2,4-triazol-4-yl)acetate.
| Compound Name | methyl 2-(3-cyano-1,2,4-triazol-4-yl)acetate |
|---|---|
| PubChem CID | 131154678 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | methyl 2-(3-cyano-1,2,4-triazol-4-yl)acetate |
| SMILES | COC(=O)Cn1cnnc1C#N |
| InChI | InChI=1S/C6H6N4O2/c1-12-6(11)3-10-4-8-9-5(10)2-7/h4H,3H2,1H3 |
| InChIKey | VSPHXKGLWPHOTP-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |