C6H6Cl2N2O2 — CID 45491733
methyl 2-(4,5-dichloroimidazol-1-yl)acetate (PubChem CID 45491733) has the molecular formula C6H6Cl2N2O2 and a molecular weight of 209.03 g/mol. Its IUPAC name is methyl 2-(4,5-dichloroimidazol-1-yl)acetate.
| Compound Name | methyl 2-(4,5-dichloroimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 45491733 |
| Molecular Formula | C6H6Cl2N2O2 |
| Molecular Weight | 209.03 g/mol |
| Exact Mass | 207.98 |
| IUPAC Name | methyl 2-(4,5-dichloroimidazol-1-yl)acetate |
| SMILES | COC(=O)Cn1cnc(Cl)c1Cl |
| InChI | InChI=1S/C6H6Cl2N2O2/c1-12-4(11)2-10-3-9-5(7)6(10)8/h3H,2H2,1H3 |
| InChIKey | RFCZCRJMGOZVDG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.03 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |