C15H17N3O2 — CID 11558110
5-ethyl-3-(1-ethyl-6-methoxyindol-3-yl)-1,2,4-oxadiazole (PubChem CID 11558110) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-ethyl-3-(1-ethyl-6-methoxyindol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-ethyl-3-(1-ethyl-6-methoxyindol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 11558110 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 5-ethyl-3-(1-ethyl-6-methoxyindol-3-yl)-1,2,4-oxadiazole |
| SMILES | CCc1nc(-c2cn(CC)c3cc(OC)ccc23)no1 |
| InChI | InChI=1S/C15H17N3O2/c1-4-14-16-15(17-20-14)12-9-18(5-2)13-8-10(19-3)6-7-11(12)13/h6-9H,4-5H2,1-3H3 |
| InChIKey | DSUAQSKWNMCGRY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |