C6H12N2O — CID 115582645
(2-methylcyclopropyl)methylurea (PubChem CID 115582645) has the molecular formula C6H12N2O and a molecular weight of 128.18 g/mol. Its IUPAC name is (2-methylcyclopropyl)methylurea.
| Compound Name | (2-methylcyclopropyl)methylurea |
|---|---|
| PubChem CID | 115582645 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | (2-methylcyclopropyl)methylurea |
| SMILES | CC1CC1CNC(N)=O |
| InChI | InChI=1S/C6H12N2O/c1-4-2-5(4)3-8-6(7)9/h4-5H,2-3H2,1H3,(H3,7,8,9) |
| InChIKey | HALUIUDLSQMONP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |