C6H11NO — CID 93476800
2-[(1S,2R)-2-methylcyclopropyl]acetamide (PubChem CID 93476800) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-[(1S,2R)-2-methylcyclopropyl]acetamide.
| Compound Name | 2-[(1S,2R)-2-methylcyclopropyl]acetamide |
|---|---|
| PubChem CID | 93476800 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2-[(1S,2R)-2-methylcyclopropyl]acetamide |
| SMILES | C[C@@H]1C[C@H]1CC(N)=O |
| InChI | InChI=1S/C6H11NO/c1-4-2-5(4)3-6(7)8/h4-5H,2-3H2,1H3,(H2,7,8)/t4-,5+/m1/s1 |
| InChIKey | PRVFNLNOTDDZIC-UHNVWZDZSA-N |
| XLogP | 0.52 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |