C10H11F3N2O2 — CID 115582842
1-phenylmethoxy-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115582842) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 1-phenylmethoxy-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-phenylmethoxy-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115582842 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-phenylmethoxy-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)NOCc1ccccc1 |
| InChI | InChI=1S/C10H11F3N2O2/c11-10(12,13)7-14-9(16)15-17-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,14,15,16) |
| InChIKey | VYDYELKXBIPSKH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|