C12H19N3O — CID 115583070
1,1-diethyl-3-(2-pyridin-2-ylethyl)urea (PubChem CID 115583070) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 1,1-diethyl-3-(2-pyridin-2-ylethyl)urea.
| Compound Name | 1,1-diethyl-3-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 115583070 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 1,1-diethyl-3-(2-pyridin-2-ylethyl)urea |
| SMILES | CCN(CC)C(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C12H19N3O/c1-3-15(4-2)12(16)14-10-8-11-7-5-6-9-13-11/h5-7,9H,3-4,8,10H2,1-2H3,(H,14,16) |
| InChIKey | TUKIJCPZLPZSJZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |