C13H17F3N4O — CID 115584173
1-piperidin-1-yl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-one (PubChem CID 115584173) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-one.
| Compound Name | 1-piperidin-1-yl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-one |
|---|---|
| PubChem CID | 115584173 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-piperidin-1-yl-2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propan-1-one |
| SMILES | CC(Nc1nccc(C(F)(F)F)n1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C13H17F3N4O/c1-9(11(21)20-7-3-2-4-8-20)18-12-17-6-5-10(19-12)13(14,15)16/h5-6,9H,2-4,7-8H2,1H3,(H,17,18,19) |
| InChIKey | IIQFAYFLTDCVIV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |