C17H32O2Si — CID 11558443
ethyl 1-[(E)-5-trimethylsilylpent-3-enyl]cyclohexane-1-carboxylate (PubChem CID 11558443) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is ethyl 1-[(E)-5-trimethylsilylpent-3-enyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[(E)-5-trimethylsilylpent-3-enyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11558443 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | ethyl 1-[(E)-5-trimethylsilylpent-3-enyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(CC/C=C/C[Si](C)(C)C)CCCCC1 |
| InChI | InChI=1S/C17H32O2Si/c1-5-19-16(18)17(12-8-6-9-13-17)14-10-7-11-15-20(2,3)4/h7,11H,5-6,8-10,12-15H2,1-4H3/b11-7+ |
| InChIKey | NDXGJZPWQAWSBV-YRNVUSSQSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|