C18H19ClO2 — CID 11558530
2-[2-(4-tert-butylphenyl)-5-chlorophenyl]acetic acid (PubChem CID 11558530) has the molecular formula C18H19ClO2 and a molecular weight of 302.80 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-5-chlorophenyl]acetic acid.
| Compound Name | 2-[2-(4-tert-butylphenyl)-5-chlorophenyl]acetic acid |
|---|---|
| PubChem CID | 11558530 |
| Molecular Formula | C18H19ClO2 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-5-chlorophenyl]acetic acid |
| SMILES | CC(C)(C)c1ccc(-c2ccc(Cl)cc2CC(=O)O)cc1 |
| InChI | InChI=1S/C18H19ClO2/c1-18(2,3)14-6-4-12(5-7-14)16-9-8-15(19)10-13(16)11-17(20)21/h4-10H,11H2,1-3H3,(H,20,21) |
| InChIKey | WHUYMVKXXLLOSY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |