C12H17N3 — CID 115587073
N-(imidazo[1,2-a]pyridin-3-ylmethyl)butan-2-amine (PubChem CID 115587073) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-3-ylmethyl)butan-2-amine.
| Compound Name | N-(imidazo[1,2-a]pyridin-3-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 115587073 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-3-ylmethyl)butan-2-amine |
| SMILES | CCC(C)NCc1cnc2ccccn12 |
| InChI | InChI=1S/C12H17N3/c1-3-10(2)13-8-11-9-14-12-6-4-5-7-15(11)12/h4-7,9-10,13H,3,8H2,1-2H3 |
| InChIKey | VULIOPGNDRMPNT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |