C14H20N4O — CID 87021486
3-(imidazo[1,2-a]pyridin-3-ylmethylamino)-N-propan-2-ylpropanamide (PubChem CID 87021486) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-3-ylmethylamino)-N-propan-2-ylpropanamide.
| Compound Name | 3-(imidazo[1,2-a]pyridin-3-ylmethylamino)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 87021486 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-3-ylmethylamino)-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCNCc1cnc2ccccn12 |
| InChI | InChI=1S/C14H20N4O/c1-11(2)17-14(19)6-7-15-9-12-10-16-13-5-3-4-8-18(12)13/h3-5,8,10-11,15H,6-7,9H2,1-2H3,(H,17,19) |
| InChIKey | LUVBKELTFJECAX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|