C13H18N2O — CID 145017960
ethane;4-imidazo[1,2-a]pyridin-3-ylbutan-2-one (PubChem CID 145017960) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is ethane;4-imidazo[1,2-a]pyridin-3-ylbutan-2-one.
| Compound Name | ethane;4-imidazo[1,2-a]pyridin-3-ylbutan-2-one |
|---|---|
| PubChem CID | 145017960 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | ethane;4-imidazo[1,2-a]pyridin-3-ylbutan-2-one |
| SMILES | CC.CC(=O)CCc1cnc2ccccn12 |
| InChI | InChI=1S/C11H12N2O.C2H6/c1-9(14)5-6-10-8-12-11-4-2-3-7-13(10)11;1-2/h2-4,7-8H,5-6H2,1H3;1-2H3 |
| InChIKey | ZPLKYGOZBLKNGI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |