C18H18BrN3O — CID 90570258
4-bromo-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylbutanamide (PubChem CID 90570258) has the molecular formula C18H18BrN3O and a molecular weight of 372.27 g/mol. Its IUPAC name is 4-bromo-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylbutanamide.
| Compound Name | 4-bromo-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylbutanamide |
|---|---|
| PubChem CID | 90570258 |
| Molecular Formula | C18H18BrN3O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 4-bromo-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylbutanamide |
| SMILES | O=C(CCCBr)N(Cc1cnc2ccccn12)c1ccccc1 |
| InChI | InChI=1S/C18H18BrN3O/c19-11-6-10-18(23)22(15-7-2-1-3-8-15)14-16-13-20-17-9-4-5-12-21(16)17/h1-5,7-9,12-13H,6,10-11,14H2 |
| InChIKey | ZXRVNSHUPRIDQF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|