C21H15F2N3O — CID 90570185
3,4-difluoro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylbenzamide (PubChem CID 90570185) has the molecular formula C21H15F2N3O and a molecular weight of 363.37 g/mol. Its IUPAC name is 3,4-difluoro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylbenzamide.
| Compound Name | 3,4-difluoro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylbenzamide |
|---|---|
| PubChem CID | 90570185 |
| Molecular Formula | C21H15F2N3O |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3,4-difluoro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylbenzamide |
| SMILES | O=C(c1ccc(F)c(F)c1)N(Cc1cnc2ccccn12)c1ccccc1 |
| InChI | InChI=1S/C21H15F2N3O/c22-18-10-9-15(12-19(18)23)21(27)26(16-6-2-1-3-7-16)14-17-13-24-20-8-4-5-11-25(17)20/h1-13H,14H2 |
| InChIKey | MEFFUAVBIKTWHX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |