C18H20N4O2 — CID 90570353
1-(imidazo[1,2-a]pyridin-3-ylmethyl)-3-(2-methoxyethyl)-1-phenylurea (PubChem CID 90570353) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(imidazo[1,2-a]pyridin-3-ylmethyl)-3-(2-methoxyethyl)-1-phenylurea.
| Compound Name | 1-(imidazo[1,2-a]pyridin-3-ylmethyl)-3-(2-methoxyethyl)-1-phenylurea |
|---|---|
| PubChem CID | 90570353 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-(imidazo[1,2-a]pyridin-3-ylmethyl)-3-(2-methoxyethyl)-1-phenylurea |
| SMILES | COCCNC(=O)N(Cc1cnc2ccccn12)c1ccccc1 |
| InChI | InChI=1S/C18H20N4O2/c1-24-12-10-19-18(23)22(15-7-3-2-4-8-15)14-16-13-20-17-9-5-6-11-21(16)17/h2-9,11,13H,10,12,14H2,1H3,(H,19,23) |
| InChIKey | NNCKLHYLWRMKSK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|