C14H18N2 — CID 145017956
ethane;3-(2-methylbuta-2,3-dienyl)imidazo[1,2-a]pyridine (PubChem CID 145017956) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is ethane;3-(2-methylbuta-2,3-dienyl)imidazo[1,2-a]pyridine.
| Compound Name | ethane;3-(2-methylbuta-2,3-dienyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 145017956 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | ethane;3-(2-methylbuta-2,3-dienyl)imidazo[1,2-a]pyridine |
| SMILES | C=C=C(C)Cc1cnc2ccccn12.CC |
| InChI | InChI=1S/C12H12N2.C2H6/c1-3-10(2)8-11-9-13-12-6-4-5-7-14(11)12;1-2/h4-7,9H,1,8H2,2H3;1-2H3 |
| InChIKey | OILMMVQGLATNAE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |