C9H10N2O7P2+2 — CID 159914387
hydroxy-[1-hydroxy-1-[hydroxy(oxo)phosphaniumyl]oxy-2-imidazo[1,2-a]pyridin-3-ylethoxy]-oxophosphanium (PubChem CID 159914387) has the molecular formula C9H10N2O7P2+2 and a molecular weight of 320.13 g/mol. Its IUPAC name is hydroxy-[1-hydroxy-1-[hydroxy(oxo)phosphaniumyl]oxy-2-imidazo[1,2-a]pyridin-3-ylethoxy]-oxophosphanium.
| Compound Name | hydroxy-[1-hydroxy-1-[hydroxy(oxo)phosphaniumyl]oxy-2-imidazo[1,2-a]pyridin-3-ylethoxy]-oxophosphanium |
|---|---|
| PubChem CID | 159914387 |
| Molecular Formula | C9H10N2O7P2+2 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | hydroxy-[1-hydroxy-1-[hydroxy(oxo)phosphaniumyl]oxy-2-imidazo[1,2-a]pyridin-3-ylethoxy]-oxophosphanium |
| SMILES | O=[P+](O)OC(O)(Cc1cnc2ccccn12)O[P+](=O)O |
| InChI | InChI=1S/C9H8N2O7P2/c12-9(17-19(13)14,18-20(15)16)5-7-6-10-8-3-1-2-4-11(7)8/h1-4,6,12H,5H2/p+2 |
| InChIKey | VJEOJBCQZMOYTD-UHFFFAOYSA-P |
| XLogP | 0.86 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|