C14H11FN2O — CID 117255900
3-[(2-fluorophenoxy)methyl]imidazo[1,2-a]pyridine (PubChem CID 117255900) has the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. Its IUPAC name is 3-[(2-fluorophenoxy)methyl]imidazo[1,2-a]pyridine.
| Compound Name | 3-[(2-fluorophenoxy)methyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117255900 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-[(2-fluorophenoxy)methyl]imidazo[1,2-a]pyridine |
| SMILES | Fc1ccccc1OCc1cnc2ccccn12 |
| InChI | InChI=1S/C14H11FN2O/c15-12-5-1-2-6-13(12)18-10-11-9-16-14-7-3-4-8-17(11)14/h1-9H,10H2 |
| InChIKey | CEPZVDDAZUOGCJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |