C11H16IN3 — CID 14602276
imidazo[1,2-a]pyridin-3-ylmethyl(trimethyl)azanium iodide (PubChem CID 14602276) has the molecular formula C11H16IN3 and a molecular weight of 317.17 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-3-ylmethyl(trimethyl)azanium iodide.
| Compound Name | imidazo[1,2-a]pyridin-3-ylmethyl(trimethyl)azanium iodide |
|---|---|
| PubChem CID | 14602276 |
| Molecular Formula | C11H16IN3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | imidazo[1,2-a]pyridin-3-ylmethyl(trimethyl)azanium iodide |
| SMILES | C[N+](C)(C)Cc1cnc2ccccn12.[I-] |
| InChI | InChI=1S/C11H16N3.HI/c1-14(2,3)9-10-8-12-11-6-4-5-7-13(10)11;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | VRNROAGRTRKHKT-UHFFFAOYSA-M |
| XLogP | -1.46 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|