C11H25N3S — CID 115587616
1-[1-(dimethylamino)-4-methylpentan-2-yl]-3-ethylthiourea (PubChem CID 115587616) has the molecular formula C11H25N3S and a molecular weight of 231.41 g/mol. Its IUPAC name is 1-[1-(dimethylamino)-4-methylpentan-2-yl]-3-ethylthiourea.
| Compound Name | 1-[1-(dimethylamino)-4-methylpentan-2-yl]-3-ethylthiourea |
|---|---|
| PubChem CID | 115587616 |
| Molecular Formula | C11H25N3S |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-[1-(dimethylamino)-4-methylpentan-2-yl]-3-ethylthiourea |
| SMILES | CCNC(=S)NC(CC(C)C)CN(C)C |
| InChI | InChI=1S/C11H25N3S/c1-6-12-11(15)13-10(7-9(2)3)8-14(4)5/h9-10H,6-8H2,1-5H3,(H2,12,13,15) |
| InChIKey | IROKOAVNYBHSAF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|