C11H22F3N3O3S — CID 115589021
2-[3-[ethyl(methylsulfonyl)amino]propylamino]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 115589021) has the molecular formula C11H22F3N3O3S and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-[3-[ethyl(methylsulfonyl)amino]propylamino]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-[3-[ethyl(methylsulfonyl)amino]propylamino]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 115589021 |
| Molecular Formula | C11H22F3N3O3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[3-[ethyl(methylsulfonyl)amino]propylamino]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CCN(CCCNC(C)C(=O)NCC(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C11H22F3N3O3S/c1-4-17(21(3,19)20)7-5-6-15-9(2)10(18)16-8-11(12,13)14/h9,15H,4-8H2,1-3H3,(H,16,18) |
| InChIKey | HZALSDYOCYYALO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|