C10H20F3N3O3S — CID 61492565
2-[3-[ethyl(methylsulfonyl)amino]propylamino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 61492565) has the molecular formula C10H20F3N3O3S and a molecular weight of 319.35 g/mol. Its IUPAC name is 2-[3-[ethyl(methylsulfonyl)amino]propylamino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[3-[ethyl(methylsulfonyl)amino]propylamino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 61492565 |
| Molecular Formula | C10H20F3N3O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[3-[ethyl(methylsulfonyl)amino]propylamino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN(CCCNCC(=O)NCC(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C10H20F3N3O3S/c1-3-16(20(2,18)19)6-4-5-14-7-9(17)15-8-10(11,12)13/h14H,3-8H2,1-2H3,(H,15,17) |
| InChIKey | ZECDOFPQJXXXPH-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|