C12H24N2O — CID 115590479
3-[(4-ethylcyclohexyl)methyl]-1,1-dimethylurea (PubChem CID 115590479) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 3-[(4-ethylcyclohexyl)methyl]-1,1-dimethylurea.
| Compound Name | 3-[(4-ethylcyclohexyl)methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 115590479 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 3-[(4-ethylcyclohexyl)methyl]-1,1-dimethylurea |
| SMILES | CCC1CCC(CNC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C12H24N2O/c1-4-10-5-7-11(8-6-10)9-13-12(15)14(2)3/h10-11H,4-9H2,1-3H3,(H,13,15) |
| InChIKey | OQEFEJUBMYKTBE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |