C13H27N3O — CID 83116093
3-[2-(cycloheptylmethylamino)ethyl]-1,1-dimethylurea (PubChem CID 83116093) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 3-[2-(cycloheptylmethylamino)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(cycloheptylmethylamino)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83116093 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 3-[2-(cycloheptylmethylamino)ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNCC1CCCCCC1 |
| InChI | InChI=1S/C13H27N3O/c1-16(2)13(17)15-10-9-14-11-12-7-5-3-4-6-8-12/h12,14H,3-11H2,1-2H3,(H,15,17) |
| InChIKey | FUNYQKQKPAPGET-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|