C8H13F3N2O — CID 115590513
1-(2,2-dimethylcyclopropyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115590513) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclopropyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2,2-dimethylcyclopropyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115590513 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-(2,2-dimethylcyclopropyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC1(C)CC1NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O/c1-7(2)3-5(7)13-6(14)12-4-8(9,10)11/h5H,3-4H2,1-2H3,(H2,12,13,14) |
| InChIKey | ITMKIMSXJCMIHS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |