C10H17F3N2O — CID 115590965
3-cyclopentyl-1-methyl-1-(3,3,3-trifluoropropyl)urea (PubChem CID 115590965) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is 3-cyclopentyl-1-methyl-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-cyclopentyl-1-methyl-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 115590965 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 3-cyclopentyl-1-methyl-1-(3,3,3-trifluoropropyl)urea |
| SMILES | CN(CCC(F)(F)F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C10H17F3N2O/c1-15(7-6-10(11,12)13)9(16)14-8-4-2-3-5-8/h8H,2-7H2,1H3,(H,14,16) |
| InChIKey | APDSZDDSTJRWEU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |