C11H18F2N2O — CID 121184660
N-cyclopentyl-4,4-difluoropiperidine-1-carboxamide (PubChem CID 121184660) has the molecular formula C11H18F2N2O and a molecular weight of 232.27 g/mol. Its IUPAC name is N-cyclopentyl-4,4-difluoropiperidine-1-carboxamide.
| Compound Name | N-cyclopentyl-4,4-difluoropiperidine-1-carboxamide |
|---|---|
| PubChem CID | 121184660 |
| Molecular Formula | C11H18F2N2O |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N-cyclopentyl-4,4-difluoropiperidine-1-carboxamide |
| SMILES | O=C(NC1CCCC1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H18F2N2O/c12-11(13)5-7-15(8-6-11)10(16)14-9-3-1-2-4-9/h9H,1-8H2,(H,14,16) |
| InChIKey | XCYTZCVOBLXQFQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |