C12H15FN2 — CID 115591783
3-[1-(2-fluorophenyl)propan-2-ylamino]propanenitrile (PubChem CID 115591783) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 3-[1-(2-fluorophenyl)propan-2-ylamino]propanenitrile.
| Compound Name | 3-[1-(2-fluorophenyl)propan-2-ylamino]propanenitrile |
|---|---|
| PubChem CID | 115591783 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-[1-(2-fluorophenyl)propan-2-ylamino]propanenitrile |
| SMILES | CC(Cc1ccccc1F)NCCC#N |
| InChI | InChI=1S/C12H15FN2/c1-10(15-8-4-7-14)9-11-5-2-3-6-12(11)13/h2-3,5-6,10,15H,4,8-9H2,1H3 |
| InChIKey | FOQGSYWGVZHLCK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|