C14H19FN2 — CID 114829727
3-[1-(2-fluorophenyl)propan-2-ylamino]pentanenitrile (PubChem CID 114829727) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is 3-[1-(2-fluorophenyl)propan-2-ylamino]pentanenitrile.
| Compound Name | 3-[1-(2-fluorophenyl)propan-2-ylamino]pentanenitrile |
|---|---|
| PubChem CID | 114829727 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 3-[1-(2-fluorophenyl)propan-2-ylamino]pentanenitrile |
| SMILES | CCC(CC#N)NC(C)Cc1ccccc1F |
| InChI | InChI=1S/C14H19FN2/c1-3-13(8-9-16)17-11(2)10-12-6-4-5-7-14(12)15/h4-7,11,13,17H,3,8,10H2,1-2H3 |
| InChIKey | XAFZDTJKWGAQCW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |