C16H24N2O2 — CID 62647467
3-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]pentanenitrile (PubChem CID 62647467) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]pentanenitrile.
| Compound Name | 3-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]pentanenitrile |
|---|---|
| PubChem CID | 62647467 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]pentanenitrile |
| SMILES | CCC(CC#N)NC(C)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-5-14(8-9-17)18-12(2)10-13-6-7-15(19-3)16(11-13)20-4/h6-7,11-12,14,18H,5,8,10H2,1-4H3 |
| InChIKey | YOAJADJDSBWLDU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |