C14H19NO2 — CID 43200513
1-(3,4-dimethoxyphenyl)-N-prop-2-ynylpropan-2-amine (PubChem CID 43200513) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-prop-2-ynylpropan-2-amine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-prop-2-ynylpropan-2-amine |
|---|---|
| PubChem CID | 43200513 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-prop-2-ynylpropan-2-amine |
| SMILES | C#CCNC(C)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H19NO2/c1-5-8-15-11(2)9-12-6-7-13(16-3)14(10-12)17-4/h1,6-7,10-11,15H,8-9H2,2-4H3 |
| InChIKey | KDCLOAJIMMQXLP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|