C13H16O3 — CID 62234963
1-(3,4-dimethoxyphenyl)pent-4-yn-2-ol (PubChem CID 62234963) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)pent-4-yn-2-ol.
| Compound Name | 1-(3,4-dimethoxyphenyl)pent-4-yn-2-ol |
|---|---|
| PubChem CID | 62234963 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)pent-4-yn-2-ol |
| SMILES | C#CCC(O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H16O3/c1-4-5-11(14)8-10-6-7-12(15-2)13(9-10)16-3/h1,6-7,9,11,14H,5,8H2,2-3H3 |
| InChIKey | TWNZVEFOTUGDGJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|