C12H11F3N2 — CID 115593678
1-[(3-methylphenyl)methyl]-3-(trifluoromethyl)pyrazole (PubChem CID 115593678) has the molecular formula C12H11F3N2 and a molecular weight of 240.23 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-[(3-methylphenyl)methyl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 115593678 |
| Molecular Formula | C12H11F3N2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-3-(trifluoromethyl)pyrazole |
| SMILES | Cc1cccc(Cn2ccc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C12H11F3N2/c1-9-3-2-4-10(7-9)8-17-6-5-11(16-17)12(13,14)15/h2-7H,8H2,1H3 |
| InChIKey | KKDQGTWWVWEDBP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |