C14H17F3N2Si — CID 103438540
trimethyl-[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]silane (PubChem CID 103438540) has the molecular formula C14H17F3N2Si and a molecular weight of 298.38 g/mol. Its IUPAC name is trimethyl-[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]silane.
| Compound Name | trimethyl-[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]silane |
|---|---|
| PubChem CID | 103438540 |
| Molecular Formula | C14H17F3N2Si |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | trimethyl-[4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(Cn2ccc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C14H17F3N2Si/c1-20(2,3)12-6-4-11(5-7-12)10-19-9-8-13(18-19)14(15,16)17/h4-9H,10H2,1-3H3 |
| InChIKey | WRTMSCJAMVQZEV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|