C8H15BrN2O — CID 115595139
3-(2-bromoprop-2-enyl)-1,1-diethylurea (PubChem CID 115595139) has the molecular formula C8H15BrN2O and a molecular weight of 235.12 g/mol. Its IUPAC name is 3-(2-bromoprop-2-enyl)-1,1-diethylurea.
| Compound Name | 3-(2-bromoprop-2-enyl)-1,1-diethylurea |
|---|---|
| PubChem CID | 115595139 |
| Molecular Formula | C8H15BrN2O |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 3-(2-bromoprop-2-enyl)-1,1-diethylurea |
| SMILES | C=C(Br)CNC(=O)N(CC)CC |
| InChI | InChI=1S/C8H15BrN2O/c1-4-11(5-2)8(12)10-6-7(3)9/h3-6H2,1-2H3,(H,10,12) |
| InChIKey | VVSVCUQCCIPOSD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |