C10H14N2O2S — CID 115597531
N'-hydroxy-2-(2-methylsulfanylethoxy)benzenecarboximidamide (PubChem CID 115597531) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is N'-hydroxy-2-(2-methylsulfanylethoxy)benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-(2-methylsulfanylethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 115597531 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | N'-hydroxy-2-(2-methylsulfanylethoxy)benzenecarboximidamide |
| SMILES | CSCCOc1ccccc1/C(N)=N/O |
| InChI | InChI=1S/C10H14N2O2S/c1-15-7-6-14-9-5-3-2-4-8(9)10(11)12-13/h2-5,13H,6-7H2,1H3,(H2,11,12) |
| InChIKey | QJULFKKMBOKEST-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|