C11H16N2O4S — CID 54914844
2-(2-ethylsulfonylethoxy)-N'-hydroxybenzenecarboximidamide (PubChem CID 54914844) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-(2-ethylsulfonylethoxy)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-(2-ethylsulfonylethoxy)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 54914844 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-(2-ethylsulfonylethoxy)-N'-hydroxybenzenecarboximidamide |
| SMILES | CCS(=O)(=O)CCOc1ccccc1/C(N)=N/O |
| InChI | InChI=1S/C11H16N2O4S/c1-2-18(15,16)8-7-17-10-6-4-3-5-9(10)11(12)13-14/h3-6,14H,2,7-8H2,1H3,(H2,12,13) |
| InChIKey | XXLOUKKPVKTHPH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|