C13H15BrF3NOS — CID 115598109
N-[(3-bromothiophen-2-yl)methyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 115598109) has the molecular formula C13H15BrF3NOS and a molecular weight of 370.23 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 115598109 |
| Molecular Formula | C13H15BrF3NOS |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCc1sccc1Br)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NOS/c14-10-5-6-20-11(10)7-18-12(19)8-3-1-2-4-9(8)13(15,16)17/h5-6,8-9H,1-4,7H2,(H,18,19) |
| InChIKey | HNNYOWDLQMPQEF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |