C10H17N3 — CID 115601364
N-(cyclohex-3-en-1-ylmethyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 115601364) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 115601364 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C1=CCC(CNC2=NCCN2)CC1 |
| InChI | InChI=1S/C10H17N3/c1-2-4-9(5-3-1)8-13-10-11-6-7-12-10/h1-2,9H,3-8H2,(H2,11,12,13) |
| InChIKey | VKAYTKCVSPALAJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|