C15H22ClN3 — CID 163776105
6-chloro-2-cyclohex-2-en-1-yl-4-cyclohex-3-en-1-yl-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 163776105) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 6-chloro-2-cyclohex-2-en-1-yl-4-cyclohex-3-en-1-yl-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 6-chloro-2-cyclohex-2-en-1-yl-4-cyclohex-3-en-1-yl-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 163776105 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 6-chloro-2-cyclohex-2-en-1-yl-4-cyclohex-3-en-1-yl-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | ClC1=NC(C2CC=CCC2)NC(C2C=CCCC2)N1 |
| InChI | InChI=1S/C15H22ClN3/c16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12/h1,3,5,9,11-14,17H,2,4,6-8,10H2,(H,18,19) |
| InChIKey | MKPWZPOFTOAERO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|