C8H18N2O2 — CID 115603454
3-(4-methoxybutan-2-yl)-1,1-dimethylurea (PubChem CID 115603454) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-(4-methoxybutan-2-yl)-1,1-dimethylurea.
| Compound Name | 3-(4-methoxybutan-2-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 115603454 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3-(4-methoxybutan-2-yl)-1,1-dimethylurea |
| SMILES | COCCC(C)NC(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O2/c1-7(5-6-12-4)9-8(11)10(2)3/h7H,5-6H2,1-4H3,(H,9,11) |
| InChIKey | XQKQETSRPHFIBO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |