About 3-(4-methoxybutan-2-yl)-1,1-dimethylurea
3-(4-methoxybutan-2-yl)-1,1-dimethylurea (PubChem CID 115603454) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-(4-methoxybutan-2-yl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(4-methoxybutan-2-yl)-1,1-dimethylurea |
| PubChem CID | 115603454 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3-(4-methoxybutan-2-yl)-1,1-dimethylurea |
| SMILES | COCCC(C)NC(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O2/c1-7(5-6-12-4)9-8(11)10(2)3/h7H,5-6H2,1-4H3,(H,9,11) |
| InChIKey | XQKQETSRPHFIBO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-methoxybutan-2-yl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxybutan-2-yl)-1,1-dimethylurea?
The IUPAC name of 3-(4-methoxybutan-2-yl)-1,1-dimethylurea (CID 115603454) is 3-(4-methoxybutan-2-yl)-1,1-dimethylurea.
What is the SMILES notation for 3-(4-methoxybutan-2-yl)-1,1-dimethylurea?
The canonical SMILES for 3-(4-methoxybutan-2-yl)-1,1-dimethylurea is COCCC(C)NC(=O)N(C)C.
What is the InChIKey of 3-(4-methoxybutan-2-yl)-1,1-dimethylurea?
The InChIKey is XQKQETSRPHFIBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-7(5-6-12-4)9-8(11)10(2)3/h7H,5-6H2,1-4H3,(H,9,11).
What are the key properties of 3-(4-methoxybutan-2-yl)-1,1-dimethylurea?
3-(4-methoxybutan-2-yl)-1,1-dimethylurea has a molecular weight of 174.24 g/mol, XLogP of 0.68, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxybutan-2-yl)-1,1-dimethylurea is sourced from PubChem (CID 115603454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).