C13H19F2NOS — CID 115604390
N-[[4-(difluoromethoxy)phenyl]methyl]-3-methylsulfanylbutan-1-amine (PubChem CID 115604390) has the molecular formula C13H19F2NOS and a molecular weight of 275.36 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-3-methylsulfanylbutan-1-amine.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-3-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 115604390 |
| Molecular Formula | C13H19F2NOS |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-3-methylsulfanylbutan-1-amine |
| SMILES | CSC(C)CCNCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H19F2NOS/c1-10(18-2)7-8-16-9-11-3-5-12(6-4-11)17-13(14)15/h3-6,10,13,16H,7-9H2,1-2H3 |
| InChIKey | VOBDEPJDNNJSLK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|